cas: 1375064-46-2 — see every product listed under this CAS number, including other names
Methyl 5-(3-pyridinyl)-1,2-oxazole-3-carboxylate, 95-<97% (CAS 1375064-46-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1421-95-97-10g |
| cas | 1375064-46-2 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 3925.46 Pln | |
| Hoffman Fine Chemicals | 25g | 7542.92 Pln | |
| Hoffman Fine Chemicals | 50g | 11881.32 Pln | |
| Hoffman Fine Chemicals | 100g | 18829.14 Pln | |
| Hoffman Fine Chemicals | 200g | 31793.30 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Methyl 5-pyridin-3-yl-1,2-oxazole-3-carboxylate (CAS 1375064-46-2) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: methyl 5-pyridin-3-yl-1,2-oxazole-3-carboxylate. InChIKey: IJYBKCVFGWEEKG-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | methyl 5-pyridin-3-yl-1,2-oxazole-3-carboxylate |
| InChIKey | IJYBKCVFGWEEKG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)C2=CN=CC=C2 |
Computed by PubChem (NCBI)