cas: 1375064-41-7 — see every product listed under this CAS number, including other names
Methyl 5-(4-Cyanophenyl)isoxazole-3-carboxylate, 98%, 98% (CAS 1375064-41-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124E4-100mg |
| cas | 1375064-41-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 1288.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylate (CAS 1375064-41-7) is a chemical compound with the molecular formula C12H8N2O3 and a molecular weight of 228.20 g/mol. IUPAC name: methyl 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylate. InChIKey: LQMGDMIENOPHGD-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O3 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | methyl 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | LQMGDMIENOPHGD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)