Products 67766-85-2
CAS 67766-85-2 appears in our catalog under these names: 5-(1H-Indol-3-yl)isoxazole-3-carboxylic acid, 95%, 5-(1H-Indol-3-yl)isoxazole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-(1H-indol-3-yl)-1,2-oxazole-3-carboxylic acid (CAS 67766-85-2) is a chemical compound with the molecular formula C12H8N2O3 and a molecular weight of 228.20 g/mol. IUPAC name: 5-(1H-indol-3-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: LTJHKDMGKKYAIF-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O3 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 5-(1H-indol-3-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | LTJHKDMGKKYAIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=CC(=NO3)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-(1H-indol-3-yl)-1,2-oxazole-3-carboxylic acid, 3-Isoxazolecarboxylic acid, 5-(1H-indol-3-yl)-, Oprea1_178097, 5-indol-3-ylisoxazole-3-carboxylic acid, 5-(3-indolyl)isoxazole-3-carboxylic acid, 5-(1~{H}-indol-3-yl)-1,2-oxazole-3-carboxylic acid, 5-(3H-Indol-3-ylidene)-2,5-dihydro-1,2-oxazole-3-carboxylic acid