CAS 16837-38-0 appears in our catalog under these names: Nicotinic anhydride, 97%, 3-Pyridinecarboxylic Anhydride, >97.0%(GC)(T), Nicotinic anhydride 97%, 3-Pyridinecarboxylic anhydride, 97%, 97%, Nicotinic anhydride. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 25g.
Pyridine-3-carbonyl pyridine-3-carboxylate (CAS 16837-38-0) is a chemical compound with the molecular formula C12H8N2O3 and a molecular weight of 228.20 g/mol. IUPAC name: pyridine-3-carbonyl pyridine-3-carboxylate. InChIKey: VPODXHOUBDCEHN-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O3 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | pyridine-3-carbonyl pyridine-3-carboxylate |
| InChIKey | VPODXHOUBDCEHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)OC(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)