CAS 1078130-59-2 appears in our catalog under these names: 6-Cyano-4-oxo-1,4-dihydro-quinoline-2-carboxylic acid methyl ester, 95%, Methyl 6-cyano-4-oxo-1,4-dihydroquinoline-2-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 10g.
Methyl 6-cyano-4-oxo-1H-quinoline-2-carboxylate (CAS 1078130-59-2) is a chemical compound with the molecular formula C12H8N2O3 and a molecular weight of 228.20 g/mol. IUPAC name: methyl 6-cyano-4-oxo-1H-quinoline-2-carboxylate. InChIKey: HWPAIPTYSWLOCZ-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O3 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | methyl 6-cyano-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | HWPAIPTYSWLOCZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)C=CC(=C2)C#N |
Computed by PubChem (NCBI)