CAS 91037-91-1 appears in our catalog under these names: 2-(2-Furoyl)-4(5)-(2-furanyl)-1h-imidazole, 95%, FFI. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 500mg, 50mg, 100mg.
Furan-2-yl-[5-(furan-2-yl)-1H-imidazol-2-yl]methanone (CAS 91037-91-1) is a chemical compound with the molecular formula C12H8N2O3 and a molecular weight of 228.20 g/mol. IUPAC name: furan-2-yl-[5-(furan-2-yl)-1H-imidazol-2-yl]methanone. InChIKey: DKZNJXJLTVYBRA-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O3 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | furan-2-yl-[5-(furan-2-yl)-1H-imidazol-2-yl]methanone |
| InChIKey | DKZNJXJLTVYBRA-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CN=C(N2)C(=O)C3=CC=CO3 |
Computed by PubChem (NCBI)