CAS 503272-05-7 is the registry number for 4-Oxo-3,5-dihydropyrrolo[2,3-c]quinoline-1-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-oxo-3,5-dihydropyrrolo[2,3-c]quinoline-1-carboxylic acid (CAS 503272-05-7) is a chemical compound with the molecular formula C12H8N2O3 and a molecular weight of 228.20 g/mol. IUPAC name: 4-oxo-3,5-dihydropyrrolo[2,3-c]quinoline-1-carboxylic acid. InChIKey: ATIJPNPQOFCHEJ-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O3 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 4-oxo-3,5-dihydropyrrolo[2,3-c]quinoline-1-carboxylic acid |
| InChIKey | ATIJPNPQOFCHEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C(=O)N2)NC=C3C(=O)O |
Computed by PubChem (NCBI)