cas: 1099632-51-5 — see every product listed under this CAS number, including other names
Methyl 5-(Chlorosulfonyl)-2,4-Difluorobenzoate, 98% (CAS 1099632-51-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1107Y3-100mg |
| cas | 1099632-51-5 |
| size | 100mg |
| availability | 4g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 1g | 1350.80 Pln | |
| Fluorochem | 100mg | 653.95 Pln | |
| Fluorochem | 250mg | 893.45 Pln | |
| Fluorochem | 1g | 1820.21 Pln | |
| Fluorochem | 5g | 5183.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-chlorosulfonyl-2,4-difluorobenzoate (CAS 1099632-51-5) is a chemical compound with the molecular formula C8H5ClF2O4S and a molecular weight of 270.64 g/mol. IUPAC name: methyl 5-chlorosulfonyl-2,4-difluorobenzoate. InChIKey: YISREXSAILYBAW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O4S |
|---|---|
| Molecular weight | 270.64 g/mol |
| IUPAC name | methyl 5-chlorosulfonyl-2,4-difluorobenzoate |
| InChIKey | YISREXSAILYBAW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)