cas: 141772-31-8 — see every product listed under this CAS number, including other names
Methyl 5-amino-2-chloro-4-fluorobenzoate 98% (CAS 141772-31-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A867052-10g |
| cas | 141772-31-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 2200.44 Pln | |
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1399.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A867052 |
Methyl 5-amino-2-chloro-4-fluorobenzoate (CAS 141772-31-8) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: methyl 5-amino-2-chloro-4-fluorobenzoate. InChIKey: GRQLIRSFYJTUQR-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | methyl 5-amino-2-chloro-4-fluorobenzoate |
| InChIKey | GRQLIRSFYJTUQR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)F)N |
Computed by PubChem (NCBI)