cas: 773873-77-1 — see every product listed under this CAS number, including other names
Methyl 5-bromo-1H-indole-3-carboxylate, 98% (CAS 773873-77-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077022-1G |
| cas | 773873-77-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 10g | 372.80 Pln | |
| Fluorochem | 25g | 768.50 Pln | |
| Fluorochem | 100g | 2658.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 5-bromo-1H-indole-3-carboxylate (CAS 773873-77-1) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: methyl 5-bromo-1H-indole-3-carboxylate. InChIKey: MFOKOKHNSVUKON-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | methyl 5-bromo-1H-indole-3-carboxylate |
| InChIKey | MFOKOKHNSVUKON-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)