cas: 83131-08-2 — see every product listed under this CAS number, including other names
Methyl 5-bromo-2,3-dimethoxybenzoate, 95%, 95% (CAS 83131-08-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119JH9-100mg |
| cas | 83131-08-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1725.20 Pln | |
| Chemat | 250mg | 2829.20 Pln | |
| Chemat | 1g | 4672.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-bromo-2,3-dimethoxybenzoate (CAS 83131-08-2) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: methyl 5-bromo-2,3-dimethoxybenzoate. InChIKey: HNLKQPLNPYMCAO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | methyl 5-bromo-2,3-dimethoxybenzoate |
| InChIKey | HNLKQPLNPYMCAO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)C(=O)OC)Br |
Computed by PubChem (NCBI)