cas: 929000-14-6 — see every product listed under this CAS number, including other names
Methyl 5-bromo-2-(methylthio)benzoate, 96%, 96% (CAS 929000-14-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117KCV-100mg |
| cas | 929000-14-6 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 909.20 Pln | |
| Chemat | 10g | 1494.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-bromo-2-methylsulfanylbenzoate (CAS 929000-14-6) is a chemical compound with the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. IUPAC name: methyl 5-bromo-2-methylsulfanylbenzoate. InChIKey: AUJZLQVDLUTYLJ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2S |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | methyl 5-bromo-2-methylsulfanylbenzoate |
| InChIKey | AUJZLQVDLUTYLJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)SC |
Computed by PubChem (NCBI)