cas: 929000-14-6 — see every product listed under this CAS number, including other names
Methyl 5-bromo-2-(methylthio)benzoate, 96% (CAS 929000-14-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334604-1G |
| cas | 929000-14-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 1028.82 Pln | |
| Fluorochem | 10g | 1893.10 Pln | |
| Fluorochem | 25g | 4465.11 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-bromo-2-methylsulfanylbenzoate (CAS 929000-14-6) is a chemical compound with the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. IUPAC name: methyl 5-bromo-2-methylsulfanylbenzoate. InChIKey: AUJZLQVDLUTYLJ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2S |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | methyl 5-bromo-2-methylsulfanylbenzoate |
| InChIKey | AUJZLQVDLUTYLJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)SC |
Computed by PubChem (NCBI)