cas: 773874-13-8 — see every product listed under this CAS number, including other names
Methyl 5-bromo-2-(trifluoromethoxy)benzoate 98% (CAS 773874-13-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A595050-100mg |
| cas | 773874-13-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1132.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A595050 |
Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS 773874-13-8) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: methyl 5-bromo-2-(trifluoromethoxy)benzoate. InChIKey: RLAXIDPRPKZATK-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | methyl 5-bromo-2-(trifluoromethoxy)benzoate |
| InChIKey | RLAXIDPRPKZATK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)OC(F)(F)F |
Computed by PubChem (NCBI)