cas: 174261-01-9 — see every product listed under this CAS number, including other names
Methyl 5-chloro-2,4-dimethoxybenzoate, 97% (CAS 174261-01-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A372679-250mg |
| cas | 174261-01-9 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 1118.11 Pln | |
| AmBeed | 25g | 11495.05 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 5-chloro-2,4-dimethoxybenzoate (CAS 174261-01-9) is a chemical compound with the molecular formula C10H11ClO4 and a molecular weight of 230.64 g/mol. IUPAC name: methyl 5-chloro-2,4-dimethoxybenzoate. InChIKey: CYBZPSKAYVKEEA-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4 |
|---|---|
| Molecular weight | 230.64 g/mol |
| IUPAC name | methyl 5-chloro-2,4-dimethoxybenzoate |
| InChIKey | CYBZPSKAYVKEEA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OC)Cl)OC |
Computed by PubChem (NCBI)