cas: 33924-48-0 — see every product listed under this CAS number, including other names
Methyl 5-chloro-2-methoxybenzoate 98% (CAS 33924-48-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A405362-5g |
| cas | 33924-48-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 426.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A405362 |
Methyl 5-chloro-2-methoxybenzoate (CAS 33924-48-0) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: methyl 5-chloro-2-methoxybenzoate. InChIKey: HPTHYBXMNNGQEF-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | methyl 5-chloro-2-methoxybenzoate |
| InChIKey | HPTHYBXMNNGQEF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)