cas: 33924-48-0 — see every product listed under this CAS number, including other names
Methyl 5-chloro-2-methoxybenzoate, 98%, 98% (CAS 33924-48-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RXL-5g |
| cas | 33924-48-0 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 100g | 309.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-chloro-2-methoxybenzoate (CAS 33924-48-0) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: methyl 5-chloro-2-methoxybenzoate. InChIKey: HPTHYBXMNNGQEF-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | methyl 5-chloro-2-methoxybenzoate |
| InChIKey | HPTHYBXMNNGQEF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)