Products 1794737-29-3
CAS 1794737-29-3 is the registry number for 5-Chloro-2-methoxy-benzoic Acid Methyl Ester-13C2,d6. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Trideuterio(113C)methyl 5-chloro-2-(trideuterio(113C)methoxy)benzoate (CAS 1794737-29-3) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 208.64 g/mol. IUPAC name: trideuterio(113C)methyl 5-chloro-2-(trideuterio(113C)methoxy)benzoate. InChIKey: HPTHYBXMNNGQEF-KLFIIISESA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | trideuterio(113C)methyl 5-chloro-2-(trideuterio(113C)methoxy)benzoate |
| InChIKey | HPTHYBXMNNGQEF-KLFIIISESA-N |
| SMILES | [2H][13C]([2H])([2H])OC1=C(C=C(C=C1)Cl)C(=O)O[13C]([2H])([2H])[2H] |
Computed by PubChem (NCBI)