cas: 1190948-26-5 — see every product listed under this CAS number, including other names
Methyl 6-(methylsulfonyl)nicotinate, 98%, 98% (CAS 1190948-26-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HEWB-100mg |
| cas | 1190948-26-5 |
| size | 100mg |
| availability | 90g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Chemat | 5g | 1749.20 Pln | |
| Chemat | 10g | 3304.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-methylsulfonylpyridine-3-carboxylate (CAS 1190948-26-5) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: methyl 6-methylsulfonylpyridine-3-carboxylate. InChIKey: UPJHUFLFEXNRTO-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | methyl 6-methylsulfonylpyridine-3-carboxylate |
| InChIKey | UPJHUFLFEXNRTO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1)S(=O)(=O)C |
Computed by PubChem (NCBI)