CAS 90222-81-4 appears in our catalog under these names: 2,3-Dihydro-benzo[1,4]dioxine-6-sulfonic acid amide, 95%, 2,3-Dihydro-1,4-benzodioxine-6-sulfonamide, 2,3-Dihydrobenzo[b][1,4]dioxine-6-sulfonamide, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 250mg, 5g, 1g, 10g, 0,5g.
2,3-dihydro-1,4-benzodioxine-6-sulfonamide (CAS 90222-81-4) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-6-sulfonamide. InChIKey: OAMPULWQGDEOHG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| InChIKey | OAMPULWQGDEOHG-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)