CAS 785803-74-9 appears in our catalog under these names: Dimethyl 3-aminothiophene-2,5-dicarboxylate, 95%, Dimethyl 3-aminothiophene-2,5-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100mg.
Dimethyl 3-aminothiophene-2,5-dicarboxylate (CAS 785803-74-9) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: dimethyl 3-aminothiophene-2,5-dicarboxylate. InChIKey: QFWYBXJEIDHWPZ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | dimethyl 3-aminothiophene-2,5-dicarboxylate |
| InChIKey | QFWYBXJEIDHWPZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(S1)C(=O)OC)N |
Computed by PubChem (NCBI)