Products 90222-79-0
CAS 90222-79-0 appears in our catalog under these names: 2-Amino-5-(methylsulfonyl)benzoic acid, 98%, 2–Amino–5–(methylsulfonyl)benzoic acid, 2-Amino-5-(methylsulfonyl)benzoic acid, 2-Amino-5-(methylsulfonyl)benzoic acid 98%, 2-Amino-5-(methylsulfonyl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 0,5g.
2-amino-5-methylsulfonylbenzoic acid (CAS 90222-79-0) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: 2-amino-5-methylsulfonylbenzoic acid. InChIKey: UJEHBAYGWFHLKV-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 2-amino-5-methylsulfonylbenzoic acid |
| InChIKey | UJEHBAYGWFHLKV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)N)C(=O)O |
Computed by PubChem (NCBI)