CAS 61081-34-3 is the registry number for 1-(Methanesulfonylmethyl)-4-nitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
1-(methylsulfonylmethyl)-4-nitrobenzene (CAS 61081-34-3) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: 1-(methylsulfonylmethyl)-4-nitrobenzene. InChIKey: XJQWZUJNHLGBQG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 1-(methylsulfonylmethyl)-4-nitrobenzene |
| InChIKey | XJQWZUJNHLGBQG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)