CAS 34263-58-6 is the registry number for 4-Amino-3-methanesulfonylbenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-amino-3-methylsulfonylbenzoic acid (CAS 34263-58-6) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: 4-amino-3-methylsulfonylbenzoic acid. InChIKey: CKXUUHUNEVUMHF-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 4-amino-3-methylsulfonylbenzoic acid |
| InChIKey | CKXUUHUNEVUMHF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)C(=O)O)N |
Computed by PubChem (NCBI)