cas: 104685-75-8 — see every product listed under this CAS number, including other names
Methyl 6-amino-5-nitronicotinate 98% (CAS 104685-75-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A360014-100mg |
| cas | 104685-75-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1638.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A360014 |
Methyl 6-amino-5-nitropyridine-3-carboxylate (CAS 104685-75-8) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: methyl 6-amino-5-nitropyridine-3-carboxylate. InChIKey: DCFLDKSHKLPIQA-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | methyl 6-amino-5-nitropyridine-3-carboxylate |
| InChIKey | DCFLDKSHKLPIQA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)