cas: 1158503-82-2 — see every product listed under this CAS number, including other names
Methyl 7-bromo-1H-indole-2-carboxylate 98% (CAS 1158503-82-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A174472-250mg |
| cas | 1158503-82-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 1104.63 Pln | |
| Ambeed | 25g | 4152.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A174472 |
Methyl 7-bromo-1H-indole-2-carboxylate (CAS 1158503-82-2) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: methyl 7-bromo-1H-indole-2-carboxylate. InChIKey: CVBRWYSFWORSON-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | methyl 7-bromo-1H-indole-2-carboxylate |
| InChIKey | CVBRWYSFWORSON-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C(=CC=C2)Br |
Computed by PubChem (NCBI)