Methyl 7-methylisoquinoline-1-carboxylate, 97%
cas: 1206977-46-9 — see every product listed under this CAS number, including other names
Methyl 7-methylisoquinoline-1-carboxylate, 97% (CAS 1206977-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A259128-100mg |
| cas | 1206977-46-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 948.88 Pln | |
| Ambeed | 250mg | 1749.88 Pln | |
| Ambeed | 1g | 4614.56 Pln | |
| Chemat | 100mg | 808.40 Pln | |
| Chemat | 250mg | 1557.20 Pln | |
| Chemat | 1g | 4845.20 Pln | |
| BLDpharm | 100mg | 930.81 Pln | |
| BLDpharm | 250mg | 1713.87 Pln | |
| BLDpharm | 1g | 5362.58 Pln | |
| Fluorochem | 100mg | 1497.41 Pln | |
| Fluorochem | 250mg | 2897.96 Pln | |
| Fluorochem | 1g | 8828.16 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 7-methylisoquinoline-1-carboxylate (CAS 1206977-46-9) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: methyl 7-methylisoquinoline-1-carboxylate. InChIKey: XOCAVISOOIRSQW-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | methyl 7-methylisoquinoline-1-carboxylate |
| InChIKey | XOCAVISOOIRSQW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=CN=C2C(=O)OC |
Computed by PubChem (NCBI)