CAS 13991-44-1 appears in our catalog under these names: Trans-4-oxo-1,2-cyclohexanedicarboxylic acid dimethyl ester, 96%, trans-Dimethyl 4-oxocyclohexane-1,2-dicarboxylate 95%, trans-Dimethyl 4-oxocyclohexane-1,2-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
Trans-dimethyl (1R,2R)-4-oxocyclohexane-1,2-dicarboxylate (CAS 13991-44-1) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: trans-dimethyl (1R,2R)-4-oxocyclohexane-1,2-dicarboxylate. InChIKey: HUKIJZIDGFUNMG-HTQZYQBOSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | trans-dimethyl (1R,2R)-4-oxocyclohexane-1,2-dicarboxylate |
| InChIKey | HUKIJZIDGFUNMG-HTQZYQBOSA-N |
| SMILES | COC(=O)[C@@H]1CCC(=O)C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)