CAS 92131-91-4 is the registry number for 1,5-Anhydro-2,3-dideoxy-D-erythro-hex-2-enitol 4,6-Diacetate. Offered by: TRC. Available pack sizes: 5g.
[(2R,3S)-3-acetyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (CAS 92131-91-4) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: [(2R,3S)-3-acetyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate. InChIKey: XICQRHJROALDID-VHSXEESVSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | [(2R,3S)-3-acetyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| InChIKey | XICQRHJROALDID-VHSXEESVSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H](C=CCO1)OC(=O)C |
Computed by PubChem (NCBI)