CAS 186803-48-5 appears in our catalog under these names: (2R,3S)-2,3,4-Trihydroxy-butyrolactone 2,3-Cyclohexyl Ketal, (2R,3S)-2,3,4-Trihydroxy-Gamma-butyrolactone 2,3-Cyclohexyl Ketal. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 50mg.
(3aR,6aS)-6-hydroxyspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-one (CAS 186803-48-5) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: (3aR,6aS)-6-hydroxyspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-one. InChIKey: GHGRKHAVPBZSIH-KJFJCRTCSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | (3aR,6aS)-6-hydroxyspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-one |
| InChIKey | GHGRKHAVPBZSIH-KJFJCRTCSA-N |
| SMILES | C1CCC2(CC1)O[C@H]3[C@@H](O2)C(=O)OC3O |
Computed by PubChem (NCBI)