CAS 21282-97-3 appears in our catalog under these names: 2-(Methacryloyloxy)ethyl acetoacetate, 95%, 2-(Methacryloyloxy)ethyl acetoacetate, 97% (stabilized with BHT), Ethylene Glycol Monoacetoacetate Monomethacrylate, Ethylene glycol monoacetoacetate monomethacrylate, Ethylene Glycol Monoacetoacetate Monomethacrylate (stabilized with BHT), >95.0%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 100g, 5g, 25g, 1g, 100ml, 2,5l, 500ml, 0,1kg.
2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate (CAS 21282-97-3) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: 2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate. InChIKey: IBDVWXAVKPRHCU-UHFFFAOYSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate |
| InChIKey | IBDVWXAVKPRHCU-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOC(=O)CC(=O)C |
Computed by PubChem (NCBI)