cas: 141452-01-9 — see every product listed under this CAS number, including other names
Methyl Indoline-5-carboxylate, 98%, 98% (CAS 141452-01-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GEI-100mg |
| cas | 141452-01-9 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 443.60 Pln | |
| Chemat | 10g | 760.40 Pln | |
| Chemat | 25g | 1437.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,3-dihydro-1H-indole-5-carboxylate (CAS 141452-01-9) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-5-carboxylate. InChIKey: VVAPQJBMJBCZMH-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-indole-5-carboxylate |
| InChIKey | VVAPQJBMJBCZMH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NCC2 |
Computed by PubChem (NCBI)