cas: 141452-01-9 — see every product listed under this CAS number, including other names
Methyl indoline-5-carboxylate, 95% (CAS 141452-01-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077336-1G |
| cas | 141452-01-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 502.97 Pln | |
| Fluorochem | 10g | 877.83 Pln | |
| Fluorochem | 25g | 1664.02 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2,3-dihydro-1H-indole-5-carboxylate (CAS 141452-01-9) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-5-carboxylate. InChIKey: VVAPQJBMJBCZMH-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-indole-5-carboxylate |
| InChIKey | VVAPQJBMJBCZMH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NCC2 |
Computed by PubChem (NCBI)