cas: 341988-36-1 — see every product listed under this CAS number, including other names
Methyl indoline-6-carboxylate, 95% (CAS 341988-36-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F079672-250MG |
| cas | 341988-36-1 |
| size | 250mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 148.92 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 888.25 Pln | |
| Fluorochem | 10g | 1585.92 Pln | |
| Fluorochem | 25g | 3085.39 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 887.69 Pln | |
| Ambeed | 10g | 1549.62 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Methyl 2,3-dihydro-1H-indole-6-carboxylate (CAS 341988-36-1) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-6-carboxylate. InChIKey: IVFIWGSRKYSLLR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-indole-6-carboxylate |
| InChIKey | IVFIWGSRKYSLLR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CCN2)C=C1 |
Computed by PubChem (NCBI)