Products 341988-36-1
CAS 341988-36-1 appears in our catalog under these names: Methyl indoline–6–carboxylate, Methyl indoline-6-carboxylate 95%, Methyl indoline-6-carboxylate, 96%, 96%, Methyl indoline-6-carboxylate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g, 50g, 100g.
Methyl 2,3-dihydro-1H-indole-6-carboxylate (CAS 341988-36-1) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-6-carboxylate. InChIKey: IVFIWGSRKYSLLR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-indole-6-carboxylate |
| InChIKey | IVFIWGSRKYSLLR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CCN2)C=C1 |
Computed by PubChem (NCBI)
Synonyms:
methyl indoline-6-carboxylate, methyl 2,3-dihydro-1H-indole-6-carboxylate, Methyl indoline-6-carboxylic acid, Methyl 2,3-dihydro-1H-indole-6-carboxylic acid, 2,3-Dihydro-1H-indole-6-carboxylic acid methyl ester, 6-Methoxycarbonyl-2,3-dihydro-1H-indole, 2,3-dihydro-1H-indole-6-carboxylic acid methyl ester hydrochloride, Methylindoline-6-carboxylate, 1H-Indole-6-carboxylic acid, 2,3-dihydro-, methyl ester, 6-methoxycarbonylindoline