cas: 17667-32-2 — see every product listed under this CAS number, including other names
Methyl-2-bromo-4,5-dimethoxybenzoate, 98% (CAS 17667-32-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F035101-1G |
| cas | 17667-32-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 1346.42 Pln | |
| Fluorochem | 10g | 2294.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-bromo-4,5-dimethoxybenzoate (CAS 17667-32-2) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: methyl 2-bromo-4,5-dimethoxybenzoate. InChIKey: BCUHOZBMHZWCGL-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | methyl 2-bromo-4,5-dimethoxybenzoate |
| InChIKey | BCUHOZBMHZWCGL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)Br)OC |
Computed by PubChem (NCBI)