CAS 14687-15-1 appears in our catalog under these names: Methyl alpha-l-fucopyranoside, 98%, Methyl α–L–Fucopyranoside, Methyl-a-L-fucopyranoside/ 99.55% (existing batch purity), Methyl a-L-fucopyranoside, Methyl alpha-L-Fucopyranoside, >98.0%(HPLC). Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, TCI. Available pack sizes: 5g, 1g, 50mg, 100mg, 500mg, 2g, 10g, 50g.
(2R,3S,4R,5S,6S)-2-methoxy-6-methyloxane-3,4,5-triol (CAS 14687-15-1) is a chemical compound with the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. IUPAC name: (2R,3S,4R,5S,6S)-2-methoxy-6-methyloxane-3,4,5-triol. InChIKey: OHWCAVRRXKJCRB-CXNFULCWSA-N.
| Molecular formula | C7H14O5 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (2R,3S,4R,5S,6S)-2-methoxy-6-methyloxane-3,4,5-triol |
| InChIKey | OHWCAVRRXKJCRB-CXNFULCWSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC)O)O)O |
Computed by PubChem (NCBI)