Methylophiopogonanone B 99%
cas: 74805-91-7 — see every product listed under this CAS number, including other names
Methylophiopogonanone B 99% (CAS 74805-91-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A634435-1mg |
| cas | 74805-91-7 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 453.81 Pln | |
| Ambeed | 5mg | 854.31 Pln | |
| Ambeed | 10mg | 1399.44 Pln | |
| Ambeed | 25mg | 2723.31 Pln | |
| Ambeed | 50mg | 4330.88 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A634435 |
(3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-2,3-dihydrochromen-4-one (CAS 74805-91-7) is a chemical compound with the molecular formula C19H20O5 and a molecular weight of 328.4 g/mol. IUPAC name: (3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-2,3-dihydrochromen-4-one. InChIKey: UFMAZRUMVFVHLY-CYBMUJFWSA-N.
| Molecular formula | C19H20O5 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-2,3-dihydrochromen-4-one |
| InChIKey | UFMAZRUMVFVHLY-CYBMUJFWSA-N |
| SMILES | CC1=C(C(=C2C(=C1O)C(=O)[C@@H](CO2)CC3=CC=C(C=C3)OC)C)O |
Computed by PubChem (NCBI)
Synonyms:
Methylophiopogonanone B, (R)-5,7-dihydroxy-3-(4-methoxybenzyl)-6,8-dimethylchroman-4-one, 8-Methylophiopogonanone B, MethylophiopogonanoneB, orb1301297, orb3140093, Methylophiopogonanone B, analytical standard, 5,7-dihydroxy-3-(4-methoxybenzyl)-6,8-dimethylchroman-4-one, (3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-chroman-4-one