CAS 74805-91-7 appears in our catalog under these names: Methylophiopogonanone B/ 99.24% (existing batch purity), Methylophiopogonanone B 99%, Methylophiopogonanone B, Methylophiopogonanone B, 99.84%. Offered by: TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 10 mg, 5 mg.
(3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-2,3-dihydrochromen-4-one (CAS 74805-91-7) is a chemical compound with the molecular formula C19H20O5 and a molecular weight of 328.4 g/mol. IUPAC name: (3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-2,3-dihydrochromen-4-one. InChIKey: UFMAZRUMVFVHLY-CYBMUJFWSA-N.
| Molecular formula | C19H20O5 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-2,3-dihydrochromen-4-one |
| InChIKey | UFMAZRUMVFVHLY-CYBMUJFWSA-N |
| SMILES | CC1=C(C(=C2C(=C1O)C(=O)[C@@H](CO2)CC3=CC=C(C=C3)OC)C)O |
Computed by PubChem (NCBI)