cas: 1138245-13-2 — see every product listed under this CAS number, including other names
Mirogabalin 98% (CAS 1138245-13-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A181027-1mg |
| cas | 1138245-13-2 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 186.81 Pln | |
| Ambeed | 5mg | 320.31 Pln | |
| Ambeed | 10mg | 403.75 Pln | |
| Ambeed | 50mg | 481.62 Pln | |
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 1905.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A181027 |
2-[(1R,5S,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (CAS 1138245-13-2) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: 2-[(1R,5S,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid. InChIKey: FTBQORVNHOIASH-CKYFFXLPSA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | 2-[(1R,5S,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| InChIKey | FTBQORVNHOIASH-CKYFFXLPSA-N |
| SMILES | CCC1=C[C@@H]2[C@H](C1)C[C@@]2(CC(=O)O)CN |
Computed by PubChem (NCBI)