CAS 73255-40-0 appears in our catalog under these names: 4–(α–L–Rhamnosyloxy)benzyl isothiocyanate, Moringin/ 99.49% (existing batch purity), Moringin, 4-(α-L-Rhamnosyloxy)benzyl isothiocyanate, 99.88% ,, 99.88% ,, Moringin, 99.95%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 5 mg, 10 mg.
(2S,3R,4R,5R,6S)-2-[4-(isothiocyanatomethyl)phenoxy]-6-methyloxane-3,4,5-triol (CAS 73255-40-0) is a chemical compound with the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. IUPAC name: (2S,3R,4R,5R,6S)-2-[4-(isothiocyanatomethyl)phenoxy]-6-methyloxane-3,4,5-triol. InChIKey: QAZIHHJTZPNRCM-CNJBRALLSA-N.
| Molecular formula | C14H17NO5S |
|---|---|
| Molecular weight | 311.36 g/mol |
| IUPAC name | (2S,3R,4R,5R,6S)-2-[4-(isothiocyanatomethyl)phenoxy]-6-methyloxane-3,4,5-triol |
| InChIKey | QAZIHHJTZPNRCM-CNJBRALLSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)CN=C=S)O)O)O |
Computed by PubChem (NCBI)