cas: 868-63-3 — see every product listed under this CAS number, including other names
N,N'-(1,2-Dihydroxyethane-1,2-diyl)diacrylamide, 98%, 98% (CAS 868-63-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SG3-100mg |
| cas | 868-63-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 285.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[1,2-dihydroxy-2-(prop-2-enoylamino)ethyl]prop-2-enamide (CAS 868-63-3) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: N-[1,2-dihydroxy-2-(prop-2-enoylamino)ethyl]prop-2-enamide. InChIKey: ZMLXKXHICXTSDM-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O4 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | N-[1,2-dihydroxy-2-(prop-2-enoylamino)ethyl]prop-2-enamide |
| InChIKey | ZMLXKXHICXTSDM-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC(C(NC(=O)C=C)O)O |
Computed by PubChem (NCBI)