cas: 94-93-9 — see every product listed under this CAS number, including other names
N,N'-Bis(salicylidene)ethylenediamine 98% (CAS 94-93-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A260347-5g |
| cas | 94-93-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 503.88 Pln | |
| Ambeed | 500g | 1716.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A260347 |
2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol (CAS 94-93-9) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol. InChIKey: VEUMANXWQDHAJV-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol |
| InChIKey | VEUMANXWQDHAJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NCCN=CC2=CC=CC=C2O)O |
Computed by PubChem (NCBI)