cas: 871269-16-8 — see every product listed under this CAS number, including other names
N,N-Dimethyl 5-Bromo-2-Methoxybenzenesulfonamide, ≥97%, ≥97% (CAS 871269-16-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115KPK-250mg |
| cas | 871269-16-8 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 741.20 Pln | |
| Chemat | 5g | 2426.00 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-methoxy-N,N-dimethylbenzenesulfonamide (CAS 871269-16-8) is a chemical compound with the molecular formula C9H12BrNO3S and a molecular weight of 294.17 g/mol. IUPAC name: 5-bromo-2-methoxy-N,N-dimethylbenzenesulfonamide. InChIKey: ZAQVQBBHHBMCPB-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO3S |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | 5-bromo-2-methoxy-N,N-dimethylbenzenesulfonamide |
| InChIKey | ZAQVQBBHHBMCPB-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=CC(=C1)Br)OC |
Computed by PubChem (NCBI)