CAS 1206096-59-4 is the registry number for 5-Bromo-2-methoxy-N,4-dimethylbenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-methoxy-N,4-dimethylbenzenesulfonamide (CAS 1206096-59-4) is a chemical compound with the molecular formula C9H12BrNO3S and a molecular weight of 294.17 g/mol. IUPAC name: 5-bromo-2-methoxy-N,4-dimethylbenzenesulfonamide. InChIKey: GXKCKCRHNWZCAM-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO3S |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | 5-bromo-2-methoxy-N,4-dimethylbenzenesulfonamide |
| InChIKey | GXKCKCRHNWZCAM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)S(=O)(=O)NC)OC |
Computed by PubChem (NCBI)