CAS 2222512-23-2 is the registry number for 4-bromo-2-methoxy-N,N-dimethylbenzenesulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-bromo-2-methoxy-N,N-dimethylbenzenesulfonamide (CAS 2222512-23-2) is a chemical compound with the molecular formula C9H12BrNO3S and a molecular weight of 294.17 g/mol. IUPAC name: 4-bromo-2-methoxy-N,N-dimethylbenzenesulfonamide. InChIKey: KQHYUUUIEUKSEM-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO3S |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | 4-bromo-2-methoxy-N,N-dimethylbenzenesulfonamide |
| InChIKey | KQHYUUUIEUKSEM-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=C(C=C1)Br)OC |
Computed by PubChem (NCBI)