CAS 28611-73-6 is the registry number for Dimethyl(2-hydroxy-5-nitrobenzyl)sulfonium bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2-hydroxy-5-nitrophenyl)methyl-dimethylsulfanium bromide (CAS 28611-73-6) is a chemical compound with the molecular formula C9H12BrNO3S and a molecular weight of 294.17 g/mol. IUPAC name: (2-hydroxy-5-nitrophenyl)methyl-dimethylsulfanium bromide. InChIKey: VEGVMTIJKACZGO-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO3S |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | (2-hydroxy-5-nitrophenyl)methyl-dimethylsulfanium bromide |
| InChIKey | VEGVMTIJKACZGO-UHFFFAOYSA-N |
| SMILES | C[S+](C)CC1=C(C=CC(=C1)[N+](=O)[O-])O.[Br-] |
Computed by PubChem (NCBI)