Products 358665-70-0
CAS 358665-70-0 is the registry number for 3-Bromo-4-methoxy-N,N-dimethylbenzenesulfonamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
3-bromo-4-methoxy-N,N-dimethylbenzenesulfonamide (CAS 358665-70-0) is a chemical compound with the molecular formula C9H12BrNO3S and a molecular weight of 294.17 g/mol. IUPAC name: 3-bromo-4-methoxy-N,N-dimethylbenzenesulfonamide. InChIKey: JWQPVEGPRFDGGO-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO3S |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | 3-bromo-4-methoxy-N,N-dimethylbenzenesulfonamide |
| InChIKey | JWQPVEGPRFDGGO-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)OC)Br |
Computed by PubChem (NCBI)