CAS 2222512-31-2 is the registry number for N-[2-(2-Bromophenyl)-2-hydroxyethyl]methanesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[2-(2-bromophenyl)-2-hydroxyethyl]methanesulfonamide (CAS 2222512-31-2) is a chemical compound with the molecular formula C9H12BrNO3S and a molecular weight of 294.17 g/mol. IUPAC name: N-[2-(2-bromophenyl)-2-hydroxyethyl]methanesulfonamide. InChIKey: HBKVFKCMFYSIBR-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO3S |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | N-[2-(2-bromophenyl)-2-hydroxyethyl]methanesulfonamide |
| InChIKey | HBKVFKCMFYSIBR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NCC(C1=CC=CC=C1Br)O |
Computed by PubChem (NCBI)