cas: 519-87-9 — see every product listed under this CAS number, including other names
N,N-Diphenylacetamide (CAS 519-87-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 100g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | AAA51987-10g |
| cas | 519-87-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 10g | price on request | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 25g | 544.62 Pln | |
| Fluorochem | 100g | 1913.93 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
N,N-diphenylacetamide (CAS 519-87-9) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: N,N-diphenylacetamide. InChIKey: DKLYDESVXZKCFI-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | N,N-diphenylacetamide |
| InChIKey | DKLYDESVXZKCFI-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)